| MolName | (Z)-1-(3-phenyl-1-thiophen-2-ylpyrazol-4-yl)-N-(1,2,4-triazol-4-yl)methanimine |
| MolecularFormula | C16H12N6S |
| Smiles | C(c1cn(-c2cccs2)nc1-c1ccccc1)=N\n1cnnc1 |
| InChI | InChI=1S/C16H12N6S/c1-2-5-13(6-3-1)16-14(9-19-21-11-17-18-12-21)10-22(20-16)15-7-4-8-23-15/h1-12H |
| InChIK | SKOANANDXYLZNX-UHFFFAOYSA-N |
| TotalMolweight | 320.379 |
| Molweight | 320.379 |
| MonoisotopicMass | 320.084414 |
| CLogP | 2.2828 |
| CLogS | -6.425 |
| H Acceptors | 6 |
| TotalSurfaceArea | 247.92 |
| Relative PSA | 0.31672 |
| PolarSurfaceArea | 89.13 |
| Druglikeness | 4.7865 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.47826 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 5 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-(3-phenyl-1-thiophen-2-ylpyrazol-4-yl)-N-(1,2,4-triazol-4-yl)methanimine | 2 - (Z)-1-(3-phenyl-1-thiophen-2-ylpyrazol-4-yl)-N-(1,2,4-triazol-4-yl)methanimine