| MolName | N-[(Z)-(4-chloro-3-nitrophenyl)methylideneamino]-2-phenylquinoline-4-carboxamide |
| MolecularFormula | C23H15N4O3Cl |
| Smiles | [O-][N+](c(cc(/C=N\NC(c1cc(-c2ccccc2)nc2ccccc12)=O)cc1)c1Cl)=O |
| InChI | InChI=1S/C23H15ClN4O3/c24-19-11-10-15(12-22(19)28(30)31)14-25-27-23(29)18-13-21(16-6-2-1-3-7-16)26-20-9-5-4-8-17(18)20/h1-14H,(H,27,29) |
| InChIK | SKSCSNDPYURYTK-UHFFFAOYSA-N |
| TotalMolweight | 430.85 |
| Molweight | 430.85 |
| MonoisotopicMass | 430.083268 |
| CLogP | 4.9522 |
| CLogS | -7.401 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 319.2 |
| Relative PSA | 0.24248 |
| PolarSurfaceArea | 100.17 |
| Druglikeness | -0.73119 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.51613 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-chloro-3-nitrophenyl)methylideneamino]-2-phenylquinoline-4-carboxamide | 2 - N-[(Z)-(4-chloro-3-nitrophenyl)methylideneamino]-2-phenylquinoline-4-carboxamide