| MolName | 4-[(Z)-[3-(furan-2-yl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]benzoate |
| MolecularFormula | C14H9N4O3S |
| Smiles | [O-]C(c1ccc(/C=N\N(C(c2ccco2)=NN2)C2=S)cc1)=O |
| InChI | InChI=1S/C14H10N4O3S/c19-13(20)10-5-3-9(4-6-10)8-15-18-12(16-17-14(18)22)11-2-1-7-21-11/h1-8H,(H,17,22)(H,19,20)/p-1 |
| InChIK | SLBSDFMMESYBCJ-UHFFFAOYSA-M |
| TotalMolweight | 313.316 |
| Molweight | 313.316 |
| MonoisotopicMass | 313.039536 |
| CLogP | -0.1072 |
| CLogS | -4.146 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 236.69 |
| Relative PSA | 0.45401 |
| PolarSurfaceArea | 125.35 |
| Druglikeness | 3.703 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.59091 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-[3-(furan-2-yl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]benzoate | 2 - 4-[(Z)-[3-(furan-2-yl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]benzoate