| MolName | N-[(3-bromophenyl)methylideneamino]-3-(3,5-dioxo-2H-1,2,4-triazin-6-yl)propanamide |
| MolecularFormula | C13H12N5O3Br |
| Smiles | O=C(CCC(C(N1)=O)=NNC1=O)NN=Cc1cccc(Br)c1 |
| InChI | InChI=1S/C13H12BrN5O3/c14-9-3-1-2-8(6-9)7-15-18-11(20)5-4-10-12(21)16-13(22)19-17-10/h1-3,6-7H,4-5H2,(H,18,20)(H2,16,19,21,22) |
| InChIK | SLJHDQCDYBSRHC-UHFFFAOYSA-N |
| TotalMolweight | 366.174 |
| Molweight | 366.174 |
| MonoisotopicMass | 365.012351 |
| CLogP | 1.6532 |
| CLogS | -4.465 |
| H Acceptors | 8 |
| H Donors | 3 |
| TotalSurfaceArea | 241.27 |
| Relative PSA | 0.40005 |
| PolarSurfaceArea | 112.02 |
| Druglikeness | 4.1154 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68182 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(3-bromophenyl)methylideneamino]-3-(3,5-dioxo-2H-1,2,4-triazin-6-yl)propanamide | 2 - N-[(3-bromophenyl)methylideneamino]-3-(3,5-dioxo-2H-1,2,4-triazin-6-yl)propanamide