| MolName | 2-chloro-N-[6-[(2Z)-2-[(2-nitrophenyl)methylidene]hydrazinyl]-6-oxohexyl]benzamide |
| MolecularFormula | C20H21N4O4Cl |
| Smiles | [O-][N+](c1c(/C=N\NC(CCCCCNC(c(cccc2)c2Cl)=O)=O)cccc1)=O |
| InChI | InChI=1S/C20H21ClN4O4/c21-17-10-5-4-9-16(17)20(27)22-13-7-1-2-12-19(26)24-23-14-15-8-3-6-11-18(15)25(28)29/h3-6,8-11,14H,1-2,7,12-13H2,(H,22,27)(H,24,26) |
| InChIK | SLVQELDBKCDLCS-UHFFFAOYSA-N |
| TotalMolweight | 416.864 |
| Molweight | 416.864 |
| MonoisotopicMass | 416.125133 |
| CLogP | 3.7873 |
| CLogS | -5.764 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 324.09 |
| Relative PSA | 0.28057 |
| PolarSurfaceArea | 116.38 |
| Druglikeness | -9.4775 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65517 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 10 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 6 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-chloro-N-[6-[(2Z)-2-[(2-nitrophenyl)methylidene]hydrazinyl]-6-oxohexyl]benzamide | 2 - 2-chloro-N-[6-[(2Z)-2-[(2-nitrophenyl)methylidene]hydrazinyl]-6-oxohexyl]benzamide