| MolName | 4-[[2-[(2Z)-2-[[2-(carboxymethoxy)phenyl]methylidene]hydrazinyl]-2-oxoacetyl]amino]benzoic acid |
| MolecularFormula | C18H15N3O7 |
| Smiles | OC(COc1c(/C=N\NC(C(Nc(cc2)ccc2C(O)=O)=O)=O)cccc1)=O |
| InChI | InChI=1S/C18H15N3O7/c22-15(23)10-28-14-4-2-1-3-12(14)9-19-21-17(25)16(24)20-13-7-5-11(6-8-13)18(26)27/h1-9H,10H2,(H,20,24)(H,21,25)(H,22,23)(H,26,27) |
| InChIK | SMJFLHJSDRFROG-UHFFFAOYSA-N |
| TotalMolweight | 385.331 |
| Molweight | 385.331 |
| MonoisotopicMass | 385.091002 |
| CLogP | 0.689 |
| CLogS | -3.331 |
| H Acceptors | 10 |
| H Donors | 4 |
| TotalSurfaceArea | 288.16 |
| Relative PSA | 0.42612 |
| PolarSurfaceArea | 154.39 |
| Druglikeness | 3.5595 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.64286 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| Amides | 1 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-[[2-[(2Z)-2-[[2-(carboxymethoxy)phenyl]methylidene]hydrazinyl]-2-oxoacetyl]amino]benzoic acid | 2 - 4-[[2-[(2Z)-2-[[2-(carboxymethoxy)phenyl]methylidene]hydrazinyl]-2-oxoacetyl]amino]benzoic acid