| MolName | [2-[(Z)-[(4-hydroxybenzoyl)hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
| MolecularFormula | C23H15N2O4ClS |
| Smiles | Oc(cc1)ccc1C(N/N=C\c(cccc1)c1OC(c(sc1c2cccc1)c2Cl)=O)=O |
| InChI | InChI=1S/C23H15ClN2O4S/c24-20-17-6-2-4-8-19(17)31-21(20)23(29)30-18-7-3-1-5-15(18)13-25-26-22(28)14-9-11-16(27)12-10-14/h1-13,27H,(H,26,28) |
| InChIK | SMTFJIRLWKLCIA-UHFFFAOYSA-N |
| TotalMolweight | 450.901 |
| Molweight | 450.901 |
| MonoisotopicMass | 450.044105 |
| CLogP | 5.8136 |
| CLogS | -6.98 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 326.81 |
| Relative PSA | 0.28307 |
| PolarSurfaceArea | 116.23 |
| Druglikeness | 5.3852 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; 3-halo-enone |
| Shape Index | 0.58065 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - [2-[(Z)-[(4-hydroxybenzoyl)hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate | 2 - [2-[(Z)-[(4-hydroxybenzoyl)hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate