| MolName | 3-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-5-phenyl-1H-imidazole-2-thione |
| MolecularFormula | C18H14N4O2S |
| Smiles | [O-][N+](c1c(/C=C/C=N\N(C=C(c2ccccc2)N2)C2=S)cccc1)=O |
| InChI | InChI=1S/C18H14N4O2S/c23-22(24)17-11-5-4-9-15(17)10-6-12-19-21-13-16(20-18(21)25)14-7-2-1-3-8-14/h1-13H,(H,20,25) |
| InChIK | SMUZIDHJZRXEBT-UHFFFAOYSA-N |
| TotalMolweight | 350.401 |
| Molweight | 350.401 |
| MonoisotopicMass | 350.083746 |
| CLogP | 2.5228 |
| CLogS | -4.969 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 273.63 |
| Relative PSA | 0.31042 |
| PolarSurfaceArea | 105.54 |
| Druglikeness | -1.6942 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-5-phenyl-1H-imidazole-2-thione | 2 - 3-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-5-phenyl-1H-imidazole-2-thione