| MolName | 2-[2-[(Z)-(4-pyridin-1-ium-2-ylpiperazin-1-yl)iminomethyl]phenoxy]acetate |
| MolecularFormula | C18H20N4O3 |
| Smiles | [O-]C(COc1c(/C=N\N(CC2)CCN2c2[nH+]cccc2)cccc1)=O |
| InChI | InChI=1S/C18H20N4O3/c23-18(24)14-25-16-6-2-1-5-15(16)13-20-22-11-9-21(10-12-22)17-7-3-4-8-19-17/h1-8,13H,9-12,14H2,(H,23,24) |
| InChIK | SMWFOTFVJKUOBP-UHFFFAOYSA-N |
| TotalMolweight | 340.382 |
| Molweight | 340.382 |
| MonoisotopicMass | 340.153541 |
| CLogP | -0.9287 |
| CLogS | -2.701 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 256.75 |
| Relative PSA | 0.21784 |
| PolarSurfaceArea | 82.34 |
| Druglikeness | 5.8657 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.64 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 8 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[2-[(Z)-(4-pyridin-1-ium-2-ylpiperazin-1-yl)iminomethyl]phenoxy]acetate | 2 - 2-[2-[(Z)-(4-pyridin-1-ium-2-ylpiperazin-1-yl)iminomethyl]phenoxy]acetate