| MolName | N-[(Z)-[1-[(4-chlorophenyl)methyl]indol-3-yl]methylideneamino]-4-morpholin-4-yl-6-piperidin-1-yl-1,3,5-triazin-2-amine |
| MolecularFormula | C28H31N8OCl |
| Smiles | Clc1ccc(Cn2c(cccc3)c3c(/C=N\Nc3nc(N4CCOCC4)nc(N4CCCCC4)n3)c2)cc1 |
| InChI | InChI=1S/C28H31ClN8O/c29-23-10-8-21(9-11-23)19-37-20-22(24-6-2-3-7-25(24)37)18-30-34-26-31-27(35-12-4-1-5-13-35)33-28(32-26)36-14-16-38-17-15-36/h2-3,6-11,18,20H,1,4-5,12-17,19H2,(H,31,32,33,34) |
| InChIK | SNAWYPLSPQMZJH-UHFFFAOYSA-N |
| TotalMolweight | 531.062 |
| Molweight | 531.062 |
| MonoisotopicMass | 530.230934 |
| CLogP | 6.9002 |
| CLogS | -6.144 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 405.7 |
| Relative PSA | 0.19682 |
| PolarSurfaceArea | 83.7 |
| Druglikeness | 1.8335 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 7 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 11 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 4 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[1-[(4-chlorophenyl)methyl]indol-3-yl]methylideneamino]-4-morpholin-4-yl-6-piperidin-1-yl-1,3,5-triazin-2-amine | 2 - N-[(Z)-[1-[(4-chlorophenyl)methyl]indol-3-yl]methylideneamino]-4-morpholin-4-yl-6-piperidin-1-yl-1,3,5-triazin-2-amine