| MolName | 2-[2-[(Z)-[5-(azepan-1-yl)-1,3,4-thiadiazol-2-yl]iminomethyl]pyrrol-1-yl]acetic acid |
| MolecularFormula | C15H19N5O2S |
| Smiles | OC(Cn1c(/C=N\c2nnc(N3CCCCCC3)s2)ccc1)=O |
| InChI | InChI=1S/C15H19N5O2S/c21-13(22)11-20-9-5-6-12(20)10-16-14-17-18-15(23-14)19-7-3-1-2-4-8-19/h5-6,9-10H,1-4,7-8,11H2,(H,21,22) |
| InChIK | SNHROBYCGCDSHZ-UHFFFAOYSA-N |
| TotalMolweight | 333.415 |
| Molweight | 333.415 |
| MonoisotopicMass | 333.125945 |
| CLogP | 1.7356 |
| CLogS | -2.521 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 257.66 |
| Relative PSA | 0.35073 |
| PolarSurfaceArea | 111.85 |
| Druglikeness | -5.0007 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.6087 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Sp3Atoms | 8 |
| Symmetricatoms | 3 |
| Aromatic Nitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[2-[(Z)-[5-(azepan-1-yl)-1,3,4-thiadiazol-2-yl]iminomethyl]pyrrol-1-yl]acetic acid | 2 - 2-[2-[(Z)-[5-(azepan-1-yl)-1,3,4-thiadiazol-2-yl]iminomethyl]pyrrol-1-yl]acetic acid