| MolName | 2-[benzenesulfonyl(furan-2-ylmethyl)amino]-N-[(Z)-naphthalen-1-ylmethylideneamino]acetamide |
| MolecularFormula | C24H21N3O4S |
| Smiles | O=C(CN(Cc1ccco1)S(c1ccccc1)(=O)=O)N/N=C\c1cccc2ccccc12 |
| InChI | InChI=1S/C24H21N3O4S/c28-24(26-25-16-20-10-6-9-19-8-4-5-14-23(19)20)18-27(17-21-11-7-15-31-21)32(29,30)22-12-2-1-3-13-22/h1-16H,17-18H2,(H,26,28) |
| InChIK | SNRSARJEMYSKPW-UHFFFAOYSA-N |
| TotalMolweight | 447.514 |
| Molweight | 447.514 |
| MonoisotopicMass | 447.125277 |
| CLogP | 3.8663 |
| CLogS | -5.233 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 337.44 |
| Relative PSA | 0.24375 |
| PolarSurfaceArea | 100.36 |
| Druglikeness | -0.97558 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 3 |
| Symmetricatoms | 3 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[benzenesulfonyl(furan-2-ylmethyl)amino]-N-[(Z)-naphthalen-1-ylmethylideneamino]acetamide | 2 - 2-[benzenesulfonyl(furan-2-ylmethyl)amino]-N-[(Z)-naphthalen-1-ylmethylideneamino]acetamide