| MolName | 3-(2-bromophenyl)-4-[(Z)-pyridin-2-ylmethylideneamino]-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C14H10N5BrS |
| Smiles | S=C(NN=C1c(cccc2)c2Br)N1/N=C\c1ncccc1 |
| InChI | InChI=1S/C14H10BrN5S/c15-12-7-2-1-6-11(12)13-18-19-14(21)20(13)17-9-10-5-3-4-8-16-10/h1-9H,(H,19,21) |
| InChIK | SNXSMTZQLURTNL-UHFFFAOYSA-N |
| TotalMolweight | 360.238 |
| Molweight | 360.238 |
| MonoisotopicMass | 358.984026 |
| CLogP | 3.0733 |
| CLogS | -4.514 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 239.11 |
| Relative PSA | 0.32203 |
| PolarSurfaceArea | 84.97 |
| Druglikeness | 1.8015 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-(2-bromophenyl)-4-[(Z)-pyridin-2-ylmethylideneamino]-1H-1,2,4-triazole-5-thione | 2 - 3-(2-bromophenyl)-4-[(Z)-pyridin-2-ylmethylideneamino]-1H-1,2,4-triazole-5-thione