| MolName | N'-[(Z)-[5-[[benzenesulfonyl-[(4-chlorophenyl)methyl]amino]methyl]furan-2-yl]methylideneamino]-N-(4-fluorophenyl)oxamide |
| MolecularFormula | C27H22N4O5ClFS |
| Smiles | O=C(C(N/N=C\c1ccc(CN(Cc(cc2)ccc2Cl)S(c2ccccc2)(=O)=O)o1)=O)Nc(cc1)ccc1F |
| InChI | InChI=1S/C27H22ClFN4O5S/c28-20-8-6-19(7-9-20)17-33(39(36,37)25-4-2-1-3-5-25)18-24-15-14-23(38-24)16-30-32-27(35)26(34)31-22-12-10-21(29)11-13-22/h1-16H,17-18H2,(H,31,34)(H,32,35) |
| InChIK | SOAUDDORUOHPKB-UHFFFAOYSA-N |
| TotalMolweight | 569.012 |
| Molweight | 569.012 |
| MonoisotopicMass | 568.098346 |
| CLogP | 4.1482 |
| CLogS | -6.066 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 413.58 |
| Relative PSA | 0.25811 |
| PolarSurfaceArea | 129.46 |
| Druglikeness | 0.25108 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.5641 |
| Fragments | 1 |
| Non HAtoms | 39 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 3 |
| Symmetricatoms | 7 |
| Amides | 2 |
| StereoCon |
Click to Load Molecule:
1 - N'-[(Z)-[5-[[benzenesulfonyl-[(4-chlorophenyl)methyl]amino]methyl]furan-2-yl]methylideneamino]-N-(4-fluorophenyl)oxamide | 2 - N'-[(Z)-[5-[[benzenesulfonyl-[(4-chlorophenyl)methyl]amino]methyl]furan-2-yl]methylideneamino]-N-(4-fluorophenyl)oxamide