| MolName | (E)-N-(2-phenylethyl)-N'-[(E)-3-phenylprop-2-enylidene]pent-2-ene-1,5-diimine |
| MolecularFormula | C22H24N2 |
| Smiles | C(C/N=C/C=C/c1ccccc1)/C=C/C=N/CCc1ccccc1 |
| InChI | InChI=1S/C22H24N2/c1-4-11-21(12-5-1)15-10-19-23-17-8-3-9-18-24-20-16-22-13-6-2-7-14-22/h1-7,9-15,18-19H,8,16-17,20H2/b9-3?,15-10?,23-19?,24-18+ |
| InChIK | SOCDGKSLFHMDPC-DIZPCBTJSA-N |
| TotalMolweight | 316.447 |
| Molweight | 316.447 |
| MonoisotopicMass | 316.193948 |
| CLogP | 4.0905 |
| CLogS | -4.369 |
| H Acceptors | 2 |
| TotalSurfaceArea | 290.58 |
| Relative PSA | 0.079221 |
| PolarSurfaceArea | 24.72 |
| Druglikeness | -0.39947 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.83333 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 2 |
| Electronegative Atoms | 2 |
| Rotatable Bond | 9 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| Symmetricatoms | 4 |
| BasicNitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - (E)-N-(2-phenylethyl)-N'-[(E)-3-phenylprop-2-enylidene]pent-2-ene-1,5-diimine | 2 - (E)-N-(2-phenylethyl)-N'-[(E)-3-phenylprop-2-enylidene]pent-2-ene-1,5-diimine