| MolName | N-[2-[(2Z)-2-[(5-iodofuran-2-yl)methylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide |
| MolecularFormula | C15H12N3O5I |
| Smiles | O=C(CNC(c(cc1)cc2c1OCO2)=O)N/N=C\c(o1)ccc1I |
| InChI | InChI=1S/C15H12IN3O5/c16-13-4-2-10(24-13)6-18-19-14(20)7-17-15(21)9-1-3-11-12(5-9)23-8-22-11/h1-6H,7-8H2,(H,17,21)(H,19,20) |
| InChIK | SOJBXAPJLHLZHB-UHFFFAOYSA-N |
| TotalMolweight | 441.176 |
| Molweight | 441.176 |
| MonoisotopicMass | 440.98217 |
| CLogP | 2.1199 |
| CLogS | -4.66 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 266.19 |
| Relative PSA | 0.35546 |
| PolarSurfaceArea | 102.16 |
| Druglikeness | 7.6505 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 4 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[2-[(2Z)-2-[(5-iodofuran-2-yl)methylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide | 2 - N-[2-[(2Z)-2-[(5-iodofuran-2-yl)methylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide