| MolName | N-[(Z)-furan-2-ylmethylideneamino]-2-(4-phenylmethoxyphenoxy)acetamide |
| MolecularFormula | C20H18N2O4 |
| Smiles | O=C(COc(cc1)ccc1OCc1ccccc1)N/N=C\c1ccco1 |
| InChI | InChI=1S/C20H18N2O4/c23-20(22-21-13-19-7-4-12-24-19)15-26-18-10-8-17(9-11-18)25-14-16-5-2-1-3-6-16/h1-13H,14-15H2,(H,22,23) |
| InChIK | SOKCHBAKEIJBOT-UHFFFAOYSA-N |
| TotalMolweight | 350.373 |
| Molweight | 350.373 |
| MonoisotopicMass | 350.126658 |
| CLogP | 3.3133 |
| CLogS | -4.524 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 283.96 |
| Relative PSA | 0.24694 |
| PolarSurfaceArea | 73.06 |
| Druglikeness | 4.1444 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.73077 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 4 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-furan-2-ylmethylideneamino]-2-(4-phenylmethoxyphenoxy)acetamide | 2 - N-[(Z)-furan-2-ylmethylideneamino]-2-(4-phenylmethoxyphenoxy)acetamide