| MolName | [2-[(Z)-[[2-[5-(furan-2-carbonylamino)-1,3,4-thiadiazol-2-yl]acetyl]hydrazinylidene]methyl]phenyl] benzenesulfonate |
| MolecularFormula | C22H17N5O6S2 |
| Smiles | O=C(Cc1nnc(NC(c2ccco2)=O)s1)N/N=C\c(cccc1)c1OS(c1ccccc1)(=O)=O |
| InChI | InChI=1S/C22H17N5O6S2/c28-19(13-20-26-27-22(34-20)24-21(29)18-11-6-12-32-18)25-23-14-15-7-4-5-10-17(15)33-35(30,31)16-8-2-1-3-9-16/h1-12,14H,13H2,(H,25,28)(H,24,27,29) |
| InChIK | SOWBTXBDPCFVHB-UHFFFAOYSA-N |
| TotalMolweight | 511.538 |
| Molweight | 511.538 |
| MonoisotopicMass | 511.062025 |
| CLogP | 3.2578 |
| CLogS | -4.861 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 371.21 |
| Relative PSA | 0.4189 |
| PolarSurfaceArea | 189.47 |
| Druglikeness | 1.7487 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 3 |
| Symmetricatoms | 3 |
| Amides | 1 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - [2-[(Z)-[[2-[5-(furan-2-carbonylamino)-1,3,4-thiadiazol-2-yl]acetyl]hydrazinylidene]methyl]phenyl] benzenesulfonate | 2 - [2-[(Z)-[[2-[5-(furan-2-carbonylamino)-1,3,4-thiadiazol-2-yl]acetyl]hydrazinylidene]methyl]phenyl] benzenesulfonate