| MolName | N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-3,6-dichloro-1-benzothiophene-2-carboxamide |
| MolecularFormula | C17H10N2O3Cl2S |
| Smiles | O=C(c(sc1c2ccc(Cl)c1)c2Cl)N/N=C\c(cc1)cc2c1OCO2 |
| InChI | InChI=1S/C17H10Cl2N2O3S/c18-10-2-3-11-14(6-10)25-16(15(11)19)17(22)21-20-7-9-1-4-12-13(5-9)24-8-23-12/h1-7H,8H2,(H,21,22) |
| InChIK | SOWIGVMKLFSQHL-UHFFFAOYSA-N |
| TotalMolweight | 393.249 |
| Molweight | 393.249 |
| MonoisotopicMass | 391.978917 |
| CLogP | 5.4462 |
| CLogS | -7.253 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 268.63 |
| Relative PSA | 0.28429 |
| PolarSurfaceArea | 88.16 |
| Druglikeness | 5.4883 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; 3-halo-enone |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Sp3Atoms | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-3,6-dichloro-1-benzothiophene-2-carboxamide | 2 - N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-3,6-dichloro-1-benzothiophene-2-carboxamide