| MolName | 2-[(Z)-[2-(4-nitrophenyl)imino-4-oxo-1,3-thiazolidin-3-yl]iminomethyl]benzoic acid |
| MolecularFormula | C17H12N4O5S |
| Smiles | [O-][N+](c(cc1)ccc1/N=C(/N1/N=C\c(cccc2)c2C(O)=O)\SCC1=O)=O |
| InChI | InChI=1S/C17H12N4O5S/c22-15-10-27-17(19-12-5-7-13(8-6-12)21(25)26)20(15)18-9-11-3-1-2-4-14(11)16(23)24/h1-9H,10H2,(H,23,24) |
| InChIK | SOZDRBYDYFPYSW-UHFFFAOYSA-N |
| TotalMolweight | 384.371 |
| Molweight | 384.371 |
| MonoisotopicMass | 384.052841 |
| CLogP | 1.291 |
| CLogS | -4.605 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 274.32 |
| Relative PSA | 0.41433 |
| PolarSurfaceArea | 153.45 |
| Druglikeness | -1.0468 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | low |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.55556 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(Z)-[2-(4-nitrophenyl)imino-4-oxo-1,3-thiazolidin-3-yl]iminomethyl]benzoic acid | 2 - 2-[(Z)-[2-(4-nitrophenyl)imino-4-oxo-1,3-thiazolidin-3-yl]iminomethyl]benzoic acid