| MolName | (E)-N-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]-3-(2-nitrophenyl)prop-2-en-1-imine |
| MolecularFormula | C22H14N3O3Cl |
| Smiles | [O-][N+](c1c(/C=C/C=N/c(cc2)cc3c2oc(-c(cc2)ccc2Cl)n3)cccc1)=O |
| InChI | InChI=1S/C22H14ClN3O3/c23-17-9-7-16(8-10-17)22-25-19-14-18(11-12-21(19)29-22)24-13-3-5-15-4-1-2-6-20(15)26(27)28/h1-14H |
| InChIK | SOZPRJAJILAUGU-UHFFFAOYSA-N |
| TotalMolweight | 403.824 |
| Molweight | 403.824 |
| MonoisotopicMass | 403.072369 |
| CLogP | 4.3909 |
| CLogS | -7.636 |
| H Acceptors | 6 |
| TotalSurfaceArea | 306.18 |
| Relative PSA | 0.21886 |
| PolarSurfaceArea | 84.21 |
| Druglikeness | -4.9976 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.62069 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (E)-N-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]-3-(2-nitrophenyl)prop-2-en-1-imine | 2 - (E)-N-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]-3-(2-nitrophenyl)prop-2-en-1-imine