| MolName | 2-amino-N-[2-(cyclohexen-1-yl)ethyl]-1-[(Z)-(4-fluorophenyl)methylideneamino]pyrrolo[3,2-b]quinoxaline-3-carboxamide |
| MolecularFormula | C26H25N6OF |
| Smiles | Nc1c(C(NCCC2=CCCCC2)=O)c2nc3ccccc3nc2n1/N=C\c(cc1)ccc1F |
| InChI | InChI=1S/C26H25FN6O/c27-19-12-10-18(11-13-19)16-30-33-24(28)22(26(34)29-15-14-17-6-2-1-3-7-17)23-25(33)32-21-9-5-4-8-20(21)31-23/h4-6,8-13,16H,1-3,7,14-15,28H2,(H,29,34) |
| InChIK | SPLIAOFEUCLJBC-UHFFFAOYSA-N |
| TotalMolweight | 456.524 |
| Molweight | 456.524 |
| MonoisotopicMass | 456.207387 |
| CLogP | 4.6548 |
| CLogS | -8.983 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 351.55 |
| Relative PSA | 0.22782 |
| PolarSurfaceArea | 98.19 |
| Druglikeness | -1.336 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.52941 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 19 |
| Sp3Atoms | 7 |
| Symmetricatoms | 2 |
| Amides | 1 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-amino-N-[2-(cyclohexen-1-yl)ethyl]-1-[(Z)-(4-fluorophenyl)methylideneamino]pyrrolo[3,2-b]quinoxaline-3-carboxamide | 2 - 2-amino-N-[2-(cyclohexen-1-yl)ethyl]-1-[(Z)-(4-fluorophenyl)methylideneamino]pyrrolo[3,2-b]quinoxaline-3-carboxamide