| MolName | 4-[(2Z)-2-[[4-(trifluoromethyl)phenyl]methylidene]hydrazinyl]phenol |
| MolecularFormula | C14H11N2OF3 |
| Smiles | Oc(cc1)ccc1N/N=C\c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H11F3N2O/c15-14(16,17)11-3-1-10(2-4-11)9-18-19-12-5-7-13(20)8-6-12/h1-9,19-20H |
| InChIK | SPMJAVFRHLYMNS-UHFFFAOYSA-N |
| TotalMolweight | 280.248 |
| Molweight | 280.248 |
| MonoisotopicMass | 280.082347 |
| CLogP | 5.3435 |
| CLogS | -3.631 |
| H Acceptors | 3 |
| H Donors | 2 |
| TotalSurfaceArea | 205.05 |
| Relative PSA | 0.17591 |
| PolarSurfaceArea | 44.62 |
| Druglikeness | -5.0198 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.7 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(2Z)-2-[[4-(trifluoromethyl)phenyl]methylidene]hydrazinyl]phenol | 2 - 4-[(2Z)-2-[[4-(trifluoromethyl)phenyl]methylidene]hydrazinyl]phenol