| MolName | 2-[N-(benzenesulfonyl)-3-bromoanilino]-N-[(Z)-naphthalen-1-ylmethylideneamino]acetamide |
| MolecularFormula | C25H20N3O3BrS |
| Smiles | O=C(CN(c1cccc(Br)c1)S(c1ccccc1)(=O)=O)N/N=C\c1cccc2ccccc12 |
| InChI | InChI=1S/C25H20BrN3O3S/c26-21-11-7-12-22(16-21)29(33(31,32)23-13-2-1-3-14-23)18-25(30)28-27-17-20-10-6-9-19-8-4-5-15-24(19)20/h1-17H,18H2,(H,28,30) |
| InChIK | SPYAVEVMDYYPCY-UHFFFAOYSA-N |
| TotalMolweight | 522.422 |
| Molweight | 522.422 |
| MonoisotopicMass | 521.040873 |
| CLogP | 4.9704 |
| CLogS | -7.366 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 352.62 |
| Relative PSA | 0.19324 |
| PolarSurfaceArea | 87.22 |
| Druglikeness | -4.4379 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.48485 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| Symmetricatoms | 3 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[N-(benzenesulfonyl)-3-bromoanilino]-N-[(Z)-naphthalen-1-ylmethylideneamino]acetamide | 2 - 2-[N-(benzenesulfonyl)-3-bromoanilino]-N-[(Z)-naphthalen-1-ylmethylideneamino]acetamide