| MolName | 3-(2-chlorophenyl)-4-[(Z)-2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino]-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C17H13N4O2ClS |
| Smiles | S=C(NN=C1c(cccc2)c2Cl)N1/N=C\c(cc1)cc2c1OCCO2 |
| InChI | InChI=1S/C17H13ClN4O2S/c18-13-4-2-1-3-12(13)16-20-21-17(25)22(16)19-10-11-5-6-14-15(9-11)24-8-7-23-14/h1-6,9-10H,7-8H2,(H,21,25) |
| InChIK | SPZWEDWGVZHFLC-UHFFFAOYSA-N |
| TotalMolweight | 372.835 |
| Molweight | 372.835 |
| MonoisotopicMass | 372.044773 |
| CLogP | 3.8798 |
| CLogS | -5.369 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 271.16 |
| Relative PSA | 0.31727 |
| PolarSurfaceArea | 90.54 |
| Druglikeness | -3.651 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.56 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 5 |
| StereoCon |
Click to Load Molecule:
1 - 3-(2-chlorophenyl)-4-[(Z)-2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino]-1H-1,2,4-triazole-5-thione | 2 - 3-(2-chlorophenyl)-4-[(Z)-2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino]-1H-1,2,4-triazole-5-thione