| MolName | N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-4-[(4-phenylpiperazin-1-yl)methyl]benzamide |
| MolecularFormula | C25H24N4OCl2 |
| Smiles | O=C(c1ccc(CN(CC2)CCN2c2ccccc2)cc1)N/N=C\c(c(Cl)ccc1)c1Cl |
| InChI | InChI=1S/C25H24Cl2N4O/c26-23-7-4-8-24(27)22(23)17-28-29-25(32)20-11-9-19(10-12-20)18-30-13-15-31(16-14-30)21-5-2-1-3-6-21/h1-12,17H,13-16,18H2,(H,29,32) |
| InChIK | SQELZGVROCBPHL-UHFFFAOYSA-N |
| TotalMolweight | 467.399 |
| Molweight | 467.399 |
| MonoisotopicMass | 466.132715 |
| CLogP | 5.6101 |
| CLogS | -6.121 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 353.49 |
| Relative PSA | 0.12196 |
| PolarSurfaceArea | 47.94 |
| Druglikeness | 8.9734 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 6 |
| Symmetricatoms | 9 |
| Amines | 2 |
| AlkylAmines | 1 |
| Aromatic Amines | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-4-[(4-phenylpiperazin-1-yl)methyl]benzamide | 2 - N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-4-[(4-phenylpiperazin-1-yl)methyl]benzamide