| MolName | 4-N-benzyl-6-morpholin-4-yl-2-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine |
| MolecularFormula | C22H22N7OF3 |
| Smiles | FC(c1c(/C=N\Nc2nc(N3CCOCC3)nc(NCc3ccccc3)n2)cccc1)(F)F |
| InChI | InChI=1S/C22H22F3N7O/c23-22(24,25)18-9-5-4-8-17(18)15-27-31-20-28-19(26-14-16-6-2-1-3-7-16)29-21(30-20)32-10-12-33-13-11-32/h1-9,15H,10-14H2,(H2,26,28,29,30,31) |
| InChIK | SQLBMLFQBJBGCI-UHFFFAOYSA-N |
| TotalMolweight | 457.459 |
| Molweight | 457.459 |
| MonoisotopicMass | 457.183792 |
| CLogP | 5.8449 |
| CLogS | -5.599 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 341.8 |
| Relative PSA | 0.23666 |
| PolarSurfaceArea | 87.56 |
| Druglikeness | -3.7004 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.48485 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 7 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 4-N-benzyl-6-morpholin-4-yl-2-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine | 2 - 4-N-benzyl-6-morpholin-4-yl-2-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine