| MolName | N-[(Z)-(4-phenyl-2-piperidin-1-yl-1,3-thiazol-5-yl)methylideneamino]-3-pyrrolidin-1-ylsulfonylbenzamide |
| MolecularFormula | C26H29N5O3S2 |
| Smiles | O=C(c1cccc(S(N2CCCC2)(=O)=O)c1)N/N=C\c1c(-c2ccccc2)nc(N2CCCCC2)s1 |
| InChI | InChI=1S/C26H29N5O3S2/c32-25(21-12-9-13-22(18-21)36(33,34)31-16-7-8-17-31)29-27-19-23-24(20-10-3-1-4-11-20)28-26(35-23)30-14-5-2-6-15-30/h1,3-4,9-13,18-19H,2,5-8,14-17H2,(H,29,32) |
| InChIK | SQMIIMKOKVEWNE-UHFFFAOYSA-N |
| TotalMolweight | 523.68 |
| Molweight | 523.68 |
| MonoisotopicMass | 523.17118 |
| CLogP | 5.3571 |
| CLogS | -6.159 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 387.47 |
| Relative PSA | 0.26588 |
| PolarSurfaceArea | 131.59 |
| Druglikeness | 1.3568 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 10 |
| Symmetricatoms | 7 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-phenyl-2-piperidin-1-yl-1,3-thiazol-5-yl)methylideneamino]-3-pyrrolidin-1-ylsulfonylbenzamide | 2 - N-[(Z)-(4-phenyl-2-piperidin-1-yl-1,3-thiazol-5-yl)methylideneamino]-3-pyrrolidin-1-ylsulfonylbenzamide