| MolName | 4-chloro-N-[(Z)-(5-chlorothiophen-2-yl)methylideneamino]benzenesulfonamide |
| MolecularFormula | C11H8N2O2Cl2S2 |
| Smiles | O=S(c(cc1)ccc1Cl)(N/N=C\c(s1)ccc1Cl)=O |
| InChI | InChI=1S/C11H8Cl2N2O2S2/c12-8-1-4-10(5-2-8)19(16,17)15-14-7-9-3-6-11(13)18-9/h1-7,15H |
| InChIK | SQTCZIRJQDYQGZ-UHFFFAOYSA-N |
| TotalMolweight | 335.235 |
| Molweight | 335.235 |
| MonoisotopicMass | 333.940422 |
| CLogP | 3.5604 |
| CLogS | -3.415 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 224.6 |
| Relative PSA | 0.32017 |
| PolarSurfaceArea | 95.15 |
| Druglikeness | 4.6773 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.68421 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 1 |
| Symmetricatoms | 3 |
| StereoCon |
Click to Load Molecule:
1 - 4-chloro-N-[(Z)-(5-chlorothiophen-2-yl)methylideneamino]benzenesulfonamide | 2 - 4-chloro-N-[(Z)-(5-chlorothiophen-2-yl)methylideneamino]benzenesulfonamide