| MolName | 5-[(Z)-[[(E)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]furan-2-sulfonic acid |
| MolecularFormula | C22H17N3O8S |
| Smiles | OS(c1ccc(/C=N\NC(/C(/NC(c2ccccc2)=O)=C\c(cc2)cc3c2OCO3)=O)o1)(=O)=O |
| InChI | InChI=1S/C22H17N3O8S/c26-21(15-4-2-1-3-5-15)24-17(10-14-6-8-18-19(11-14)32-13-31-18)22(27)25-23-12-16-7-9-20(33-16)34(28,29)30/h1-12H,13H2,(H,24,26)(H,25,27)(H,28,29,30) |
| InChIK | SRQGZPBFZIOQEJ-UHFFFAOYSA-N |
| TotalMolweight | 483.456 |
| Molweight | 483.456 |
| MonoisotopicMass | 483.073637 |
| CLogP | 1.9865 |
| CLogS | -4.228 |
| H Acceptors | 11 |
| H Donors | 3 |
| TotalSurfaceArea | 345.55 |
| Relative PSA | 0.39444 |
| PolarSurfaceArea | 164.91 |
| Druglikeness | 6.8958 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.47059 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 5 |
| Symmetricatoms | 3 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 5-[(Z)-[[(E)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]furan-2-sulfonic acid | 2 - 5-[(Z)-[[(E)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]furan-2-sulfonic acid