| MolName | 4-[5-[(Z)-[[4-morpholin-4-yl-6-(naphthalen-1-ylamino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]furan-2-yl]benzoic acid |
| MolecularFormula | C29H25N7O4 |
| Smiles | OC(c(cc1)ccc1-c1ccc(/C=N\Nc2nc(N3CCOCC3)nc(Nc3cccc4ccccc34)n2)o1)=O |
| InChI | InChI=1S/C29H25N7O4/c37-26(38)21-10-8-20(9-11-21)25-13-12-22(40-25)18-30-35-28-32-27(33-29(34-28)36-14-16-39-17-15-36)31-24-7-3-5-19-4-1-2-6-23(19)24/h1-13,18H,14-17H2,(H,37,38)(H2,31,32,33,34,35) |
| InChIK | SRZIORJISFEUNM-UHFFFAOYSA-N |
| TotalMolweight | 535.563 |
| Molweight | 535.563 |
| MonoisotopicMass | 535.196803 |
| CLogP | 6.5691 |
| CLogS | -8.095 |
| H Acceptors | 11 |
| H Donors | 3 |
| TotalSurfaceArea | 406.73 |
| Relative PSA | 0.29784 |
| PolarSurfaceArea | 138 |
| Druglikeness | 5.1873 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.525 |
| Fragments | 1 |
| Non HAtoms | 40 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 27 |
| Sp3Atoms | 6 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[5-[(Z)-[[4-morpholin-4-yl-6-(naphthalen-1-ylamino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]furan-2-yl]benzoic acid | 2 - 4-[5-[(Z)-[[4-morpholin-4-yl-6-(naphthalen-1-ylamino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]furan-2-yl]benzoic acid