| MolName | (2E)-1,2-diphenyl-2-[(Z)-[4-(trifluoromethyl)phenyl]methylidenehydrazinylidene]ethanone |
| MolecularFormula | C22H15N2OF3 |
| Smiles | O=C(/C(/c1ccccc1)=N/N=C\c1ccc(C(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H15F3N2O/c23-22(24,25)19-13-11-16(12-14-19)15-26-27-20(17-7-3-1-4-8-17)21(28)18-9-5-2-6-10-18/h1-15H |
| InChIK | SSAQKRFJJAUJCG-UHFFFAOYSA-N |
| TotalMolweight | 380.368 |
| Molweight | 380.368 |
| MonoisotopicMass | 380.113647 |
| CLogP | 6.1254 |
| CLogS | -6.586 |
| H Acceptors | 3 |
| TotalSurfaceArea | 287.72 |
| Relative PSA | 0.12533 |
| PolarSurfaceArea | 41.79 |
| Druglikeness | -4.3928 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.53571 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 1 |
| Symmetricatoms | 8 |
| StereoCon |
Click to Load Molecule:
1 - (2E)-1,2-diphenyl-2-[(Z)-[4-(trifluoromethyl)phenyl]methylidenehydrazinylidene]ethanone | 2 - (2E)-1,2-diphenyl-2-[(Z)-[4-(trifluoromethyl)phenyl]methylidenehydrazinylidene]ethanone