| MolName | N-[(Z)-(3,4-dichlorophenyl)methylideneamino]quinoline-2-carboxamide |
| MolecularFormula | C17H11N3OCl2 |
| Smiles | O=C(c1nc2ccccc2cc1)N/N=C\c(cc1)cc(Cl)c1Cl |
| InChI | InChI=1S/C17H11Cl2N3O/c18-13-7-5-11(9-14(13)19)10-20-22-17(23)16-8-6-12-3-1-2-4-15(12)21-16/h1-10H,(H,22,23) |
| InChIK | SSNLVFKZOHRCFX-UHFFFAOYSA-N |
| TotalMolweight | 344.2 |
| Molweight | 344.2 |
| MonoisotopicMass | 343.027916 |
| CLogP | 4.7836 |
| CLogS | -5.923 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 251.19 |
| Relative PSA | 0.18703 |
| PolarSurfaceArea | 54.35 |
| Druglikeness | 4.4715 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65217 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(3,4-dichlorophenyl)methylideneamino]quinoline-2-carboxamide | 2 - N-[(Z)-(3,4-dichlorophenyl)methylideneamino]quinoline-2-carboxamide