| MolName | 4-(4-bromophenyl)-N-[(E)-(3-phenylmethoxyphenyl)methylideneamino]-1,3-thiazol-2-amine |
| MolecularFormula | C23H18N3OBrS |
| Smiles | Brc(cc1)ccc1-c1csc(N/N=C/c2cc(OCc3ccccc3)ccc2)n1 |
| InChI | InChI=1S/C23H18BrN3OS/c24-20-11-9-19(10-12-20)22-16-29-23(26-22)27-25-14-18-7-4-8-21(13-18)28-15-17-5-2-1-3-6-17/h1-14,16H,15H2,(H,26,27) |
| InChIK | STCFLDKYOVXKJW-UHFFFAOYSA-N |
| TotalMolweight | 464.386 |
| Molweight | 464.386 |
| MonoisotopicMass | 463.035393 |
| CLogP | 8.2897 |
| CLogS | -6.835 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 325.85 |
| Relative PSA | 0.19733 |
| PolarSurfaceArea | 74.75 |
| Druglikeness | 1.7205 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.68966 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-(4-bromophenyl)-N-[(E)-(3-phenylmethoxyphenyl)methylideneamino]-1,3-thiazol-2-amine | 2 - 4-(4-bromophenyl)-N-[(E)-(3-phenylmethoxyphenyl)methylideneamino]-1,3-thiazol-2-amine