| MolName | 4-(2,4-dichlorophenyl)-N-[(Z)-pyridin-3-ylmethylideneamino]-1,3-thiazol-2-amine |
| MolecularFormula | C15H10N4Cl2S |
| Smiles | Clc(cc1)cc(Cl)c1-c1csc(N/N=C\c2cnccc2)n1 |
| InChI | InChI=1S/C15H10Cl2N4S/c16-11-3-4-12(13(17)6-11)14-9-22-15(20-14)21-19-8-10-2-1-5-18-7-10/h1-9H,(H,20,21) |
| InChIK | STHOOYABVADJOH-UHFFFAOYSA-N |
| TotalMolweight | 349.244 |
| Molweight | 349.244 |
| MonoisotopicMass | 348.00032 |
| CLogP | 6.4275 |
| CLogS | -5.337 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 253.3 |
| Relative PSA | 0.25768 |
| PolarSurfaceArea | 78.41 |
| Druglikeness | 4.0061 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.68182 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-(2,4-dichlorophenyl)-N-[(Z)-pyridin-3-ylmethylideneamino]-1,3-thiazol-2-amine | 2 - 4-(2,4-dichlorophenyl)-N-[(Z)-pyridin-3-ylmethylideneamino]-1,3-thiazol-2-amine