| MolName | 2-(2-chlorophenyl)-N-[(Z)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]quinazolin-4-amine |
| MolecularFormula | C21H10N4ClF5 |
| Smiles | Fc(c(/C=N\Nc1nc(-c(cccc2)c2Cl)nc2ccccc12)c(c(F)c1F)F)c1F |
| InChI | InChI=1S/C21H10ClF5N4/c22-13-7-3-1-5-10(13)20-29-14-8-4-2-6-11(14)21(30-20)31-28-9-12-15(23)17(25)19(27)18(26)16(12)24/h1-9H,(H,29,30,31) |
| InChIK | STTKSFUFAZDRBD-UHFFFAOYSA-N |
| TotalMolweight | 448.781 |
| Molweight | 448.781 |
| MonoisotopicMass | 448.051413 |
| CLogP | 7.699 |
| CLogS | -8.622 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 308.29 |
| Relative PSA | 0.14567 |
| PolarSurfaceArea | 50.17 |
| Druglikeness | 1.0445 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; polyhalo aromatic ring |
| Shape Index | 0.48387 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-(2-chlorophenyl)-N-[(Z)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]quinazolin-4-amine | 2 - 2-(2-chlorophenyl)-N-[(Z)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]quinazolin-4-amine