| MolName | 1-(2-hydroxyethyl)-N-[(Z)-(4-nitrophenyl)methylideneamino]pyridin-1-ium-3-carboxamide |
| MolecularFormula | C15H15N4O4 |
| Smiles | [O-][N+](c1ccc(/C=N\NC(c2c[n+](CCO)ccc2)=O)cc1)=O |
| InChI | InChI=1S/C15H14N4O4/c20-9-8-18-7-1-2-13(11-18)15(21)17-16-10-12-3-5-14(6-4-12)19(22)23/h1-7,10-11,20H,8-9H2/p+1 |
| InChIK | STWWJRWDOLJUMB-UHFFFAOYSA-O |
| TotalMolweight | 315.308 |
| Molweight | 315.308 |
| MonoisotopicMass | 315.109331 |
| CLogP | -3.3152 |
| CLogS | -2.547 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 241.83 |
| Relative PSA | 0.34028 |
| PolarSurfaceArea | 111.39 |
| Druglikeness | -0.8975 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.69565 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-(2-hydroxyethyl)-N-[(Z)-(4-nitrophenyl)methylideneamino]pyridin-1-ium-3-carboxamide | 2 - 1-(2-hydroxyethyl)-N-[(Z)-(4-nitrophenyl)methylideneamino]pyridin-1-ium-3-carboxamide