| MolName | [(E)-[3-(3-oxobenzo[f]chromen-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]thiourea |
| MolecularFormula | C24H17N5O2S |
| Smiles | NC(N/N=C/c1cn(-c2ccccc2)nc1C1=Cc(c2ccccc2cc2)c2OC1=O)=S |
| InChI | InChI=1S/C24H17N5O2S/c25-24(32)27-26-13-16-14-29(17-7-2-1-3-8-17)28-22(16)20-12-19-18-9-5-4-6-15(18)10-11-21(19)31-23(20)30/h1-14H,(H3,25,27,32) |
| InChIK | STXFKTRMXFRJIO-UHFFFAOYSA-N |
| TotalMolweight | 439.498 |
| Molweight | 439.498 |
| MonoisotopicMass | 439.110295 |
| CLogP | 3.0422 |
| CLogS | -5.974 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 331.75 |
| Relative PSA | 0.32289 |
| PolarSurfaceArea | 126.62 |
| Druglikeness | 4.3378 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.4375 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - [(E)-[3-(3-oxobenzo[f]chromen-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]thiourea | 2 - [(E)-[3-(3-oxobenzo[f]chromen-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]thiourea