| MolName | N-[(Z)-(3-nitrophenyl)methylideneamino]-2-[5-phenyl-3-(trifluoromethyl)pyrazol-1-yl]-1,3-thiazole-4-carboxamide |
| MolecularFormula | C21H13N6O3F3S |
| Smiles | [O-][N+](c1cccc(/C=N\NC(c2csc(-n3nc(C(F)(F)F)cc3-c3ccccc3)n2)=O)c1)=O |
| InChI | InChI=1S/C21H13F3N6O3S/c22-21(23,24)18-10-17(14-6-2-1-3-7-14)29(28-18)20-26-16(12-34-20)19(31)27-25-11-13-5-4-8-15(9-13)30(32)33/h1-12H,(H,27,31) |
| InChIK | STYNODQJVHOSEN-UHFFFAOYSA-N |
| TotalMolweight | 486.433 |
| Molweight | 486.433 |
| MonoisotopicMass | 486.072193 |
| CLogP | 3.6613 |
| CLogS | -5.442 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 342.3 |
| Relative PSA | 0.33772 |
| PolarSurfaceArea | 146.23 |
| Druglikeness | -9.3519 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.52941 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(3-nitrophenyl)methylideneamino]-2-[5-phenyl-3-(trifluoromethyl)pyrazol-1-yl]-1,3-thiazole-4-carboxamide | 2 - N-[(Z)-(3-nitrophenyl)methylideneamino]-2-[5-phenyl-3-(trifluoromethyl)pyrazol-1-yl]-1,3-thiazole-4-carboxamide