| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-5-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)triazole-4-carboxamide |
| MolecularFormula | C16H13N9O2Cl2S2 |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c(c(Cl)ccc2)c2Cl)=O)c1CSC1=NCCS1 |
| InChI | InChI=1S/C16H13Cl2N9O2S2/c17-9-2-1-3-10(18)8(9)6-21-23-15(28)12-11(7-31-16-20-4-5-30-16)27(26-22-12)14-13(19)24-29-25-14/h1-3,6H,4-5,7H2,(H2,19,24)(H,23,28) |
| InChIK | STZAFUIRSTXOQR-UHFFFAOYSA-N |
| TotalMolweight | 498.378 |
| Molweight | 498.378 |
| MonoisotopicMass | 497.001065 |
| CLogP | 4.2972 |
| CLogS | -4.895 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 345.77 |
| Relative PSA | 0.47034 |
| PolarSurfaceArea | 200.07 |
| Druglikeness | 2.6875 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.48387 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 15 |
| Electronegative Atoms | 15 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 5 |
| Symmetricatoms | 3 |
| Aromatic Nitrogens | 5 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-5-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-5-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)triazole-4-carboxamide