| MolName | N-[(E)-(3-nitrophenyl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| MolecularFormula | C17H15N5O2S |
| Smiles | [O-][N+](c1cccc(/C=N/Nc2c(c(CCCC3)c3s3)c3ncn2)c1)=O |
| InChI | InChI=1S/C17H15N5O2S/c23-22(24)12-5-3-4-11(8-12)9-20-21-16-15-13-6-1-2-7-14(13)25-17(15)19-10-18-16/h3-5,8-10H,1-2,6-7H2,(H,18,19,21) |
| InChIK | STZMEAFXWDJBIT-UHFFFAOYSA-N |
| TotalMolweight | 353.405 |
| Molweight | 353.405 |
| MonoisotopicMass | 353.094645 |
| CLogP | 4.9819 |
| CLogS | -6.298 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 262.51 |
| Relative PSA | 0.36452 |
| PolarSurfaceArea | 124.23 |
| Druglikeness | -6.5934 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.56 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Sp3Atoms | 5 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(E)-(3-nitrophenyl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine | 2 - N-[(E)-(3-nitrophenyl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine