| MolName | 4-amino-N-[(Z)-(4-piperidin-1-ylphenyl)methylideneamino]benzamide |
| MolecularFormula | C19H22N4O |
| Smiles | Nc(cc1)ccc1C(N/N=C\c(cc1)ccc1N1CCCCC1)=O |
| InChI | InChI=1S/C19H22N4O/c20-17-8-6-16(7-9-17)19(24)22-21-14-15-4-10-18(11-5-15)23-12-2-1-3-13-23/h4-11,14H,1-3,12-13,20H2,(H,22,24) |
| InChIK | SUJCWQRXUKJIQR-UHFFFAOYSA-N |
| TotalMolweight | 322.411 |
| Molweight | 322.411 |
| MonoisotopicMass | 322.179361 |
| CLogP | 3.3573 |
| CLogS | -4.789 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 261.11 |
| Relative PSA | 0.20999 |
| PolarSurfaceArea | 70.72 |
| Druglikeness | 4.3459 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.70833 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 5 |
| Symmetricatoms | 6 |
| Amines | 2 |
| Aromatic Amines | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-amino-N-[(Z)-(4-piperidin-1-ylphenyl)methylideneamino]benzamide | 2 - 4-amino-N-[(Z)-(4-piperidin-1-ylphenyl)methylideneamino]benzamide