| MolName | N-[(Z)-(4,5-dibromothiophen-2-yl)methylideneamino]-4-fluorobenzamide |
| MolecularFormula | C12H7N2OBr2FS |
| Smiles | O=C(c(cc1)ccc1F)N/N=C\c(s1)cc(Br)c1Br |
| InChI | InChI=1S/C12H7Br2FN2OS/c13-10-5-9(19-11(10)14)6-16-17-12(18)7-1-3-8(15)4-2-7/h1-6H,(H,17,18) |
| InChIK | SVASZBYZVRUIPH-UHFFFAOYSA-N |
| TotalMolweight | 406.073 |
| Molweight | 406.073 |
| MonoisotopicMass | 403.862983 |
| CLogP | 4.8241 |
| CLogS | -5.73 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 226.54 |
| Relative PSA | 0.24883 |
| PolarSurfaceArea | 69.7 |
| Druglikeness | -1.1786 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | 1,2-dihalo-alkene; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68421 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4,5-dibromothiophen-2-yl)methylideneamino]-4-fluorobenzamide | 2 - N-[(Z)-(4,5-dibromothiophen-2-yl)methylideneamino]-4-fluorobenzamide