| MolName | [2,4-dibromo-6-[(Z)-[[2-(furan-2-carbonylamino)acetyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate |
| MolecularFormula | C19H13N3O6Br2 |
| Smiles | O=C(CNC(c1ccco1)=O)N/N=C\c1cc(Br)cc(Br)c1OC(c1ccco1)=O |
| InChI | InChI=1S/C19H13Br2N3O6/c20-12-7-11(17(13(21)8-12)30-19(27)15-4-2-6-29-15)9-23-24-16(25)10-22-18(26)14-3-1-5-28-14/h1-9H,10H2,(H,22,26)(H,24,25) |
| InChIK | SVKVRLIONDBPNT-UHFFFAOYSA-N |
| TotalMolweight | 539.135 |
| Molweight | 539.135 |
| MonoisotopicMass | 536.917109 |
| CLogP | 3.5436 |
| CLogS | -5.99 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 334.11 |
| Relative PSA | 0.33453 |
| PolarSurfaceArea | 123.14 |
| Druglikeness | 3.5254 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.56667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [2,4-dibromo-6-[(Z)-[[2-(furan-2-carbonylamino)acetyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate | 2 - [2,4-dibromo-6-[(Z)-[[2-(furan-2-carbonylamino)acetyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate