| MolName | 4-chloro-3-[(4-chlorophenyl)sulfamoyl]-N-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]benzamide |
| MolecularFormula | C24H22N4O4Cl2S |
| Smiles | O=C(c(cc1)cc(S(Nc(cc2)ccc2Cl)(=O)=O)c1Cl)N/N=C\c(cc1)ccc1N1CCOCC1 |
| InChI | InChI=1S/C24H22Cl2N4O4S/c25-19-4-6-20(7-5-19)29-35(32,33)23-15-18(3-10-22(23)26)24(31)28-27-16-17-1-8-21(9-2-17)30-11-13-34-14-12-30/h1-10,15-16,29H,11-14H2,(H,28,31) |
| InChIK | SWCFCXYSUDKGJH-UHFFFAOYSA-N |
| TotalMolweight | 533.435 |
| Molweight | 533.435 |
| MonoisotopicMass | 532.07388 |
| CLogP | 4.3817 |
| CLogS | -6.629 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 379.47 |
| Relative PSA | 0.23612 |
| PolarSurfaceArea | 108.48 |
| Druglikeness | 6.8206 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.62857 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 6 |
| Symmetricatoms | 7 |
| Amides | 1 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-chloro-3-[(4-chlorophenyl)sulfamoyl]-N-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]benzamide | 2 - 4-chloro-3-[(4-chlorophenyl)sulfamoyl]-N-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]benzamide