| MolName | N-[(Z)-(3-chlorophenyl)methylideneamino]-2,2-diphenylcyclopropane-1-carboxamide |
| MolecularFormula | C23H19N2OCl |
| Smiles | O=C(C(C1)C1(c1ccccc1)c1ccccc1)N/N=C\c1cccc(Cl)c1 |
| InChI | InChI=1S/C23H19ClN2O/c24-20-13-7-8-17(14-20)16-25-26-22(27)21-15-23(21,18-9-3-1-4-10-18)19-11-5-2-6-12-19/h1-14,16,21H,15H2,(H,26,27)/t21-/m1/s1 |
| InChIK | SWGJWPLGXPEQLJ-OAQYLSRUSA-N |
| TotalMolweight | 374.87 |
| Molweight | 374.87 |
| MonoisotopicMass | 374.11859 |
| CLogP | 5.4138 |
| CLogS | -5.438 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 285.34 |
| Relative PSA | 0.1262 |
| PolarSurfaceArea | 41.46 |
| Druglikeness | 5.6336 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.51852 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| StereoCenters | 1 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| Symmetricatoms | 8 |
| StereoCon | racemate |
Click to Load Molecule:
1 - N-[(Z)-(3-chlorophenyl)methylideneamino]-2,2-diphenylcyclopropane-1-carboxamide | 2 - N-[(Z)-(3-chlorophenyl)methylideneamino]-2,2-diphenylcyclopropane-1-carboxamide