| MolName | 3-(2-chlorophenyl)-4-[(Z)-(3-nitrophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C15H10N5O2ClS |
| Smiles | [O-][N+](c1cccc(/C=N\N(C(c(cccc2)c2Cl)=NN2)C2=S)c1)=O |
| InChI | InChI=1S/C15H10ClN5O2S/c16-13-7-2-1-6-12(13)14-18-19-15(24)20(14)17-9-10-4-3-5-11(8-10)21(22)23/h1-9H,(H,19,24) |
| InChIK | SWIBKIWANKLUHB-UHFFFAOYSA-N |
| TotalMolweight | 359.796 |
| Molweight | 359.796 |
| MonoisotopicMass | 359.024372 |
| CLogP | 2.9794 |
| CLogS | -5.647 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 260.81 |
| Relative PSA | 0.36981 |
| PolarSurfaceArea | 117.9 |
| Druglikeness | -1.5955 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.54167 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-(2-chlorophenyl)-4-[(Z)-(3-nitrophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione | 2 - 3-(2-chlorophenyl)-4-[(Z)-(3-nitrophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione