| MolName | N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-2-[[4-(1,3-dithiolan-2-yl)phenoxy]methyl]-1,3-thiazole-4-carboxamide |
| MolecularFormula | C21H17N3O2Cl2S3 |
| Smiles | O=C(c1csc(COc2ccc(C3SCCS3)cc2)n1)N/N=C\c(c(Cl)ccc1)c1Cl |
| InChI | InChI=1S/C21H17Cl2N3O2S3/c22-16-2-1-3-17(23)15(16)10-24-26-20(27)18-12-31-19(25-18)11-28-14-6-4-13(5-7-14)21-29-8-9-30-21/h1-7,10,12,21H,8-9,11H2,(H,26,27) |
| InChIK | SWLGIBNJKYQXHW-UHFFFAOYSA-N |
| TotalMolweight | 510.489 |
| Molweight | 510.489 |
| MonoisotopicMass | 508.985991 |
| CLogP | 5.2694 |
| CLogS | -6.745 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 357.55 |
| Relative PSA | 0.31414 |
| PolarSurfaceArea | 142.42 |
| Druglikeness | 2.3193 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.64516 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 7 |
| Symmetricatoms | 7 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-2-[[4-(1,3-dithiolan-2-yl)phenoxy]methyl]-1,3-thiazole-4-carboxamide | 2 - N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-2-[[4-(1,3-dithiolan-2-yl)phenoxy]methyl]-1,3-thiazole-4-carboxamide