| MolName | 2-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-N-[(Z)-furan-2-ylmethylideneamino]acetamide |
| MolecularFormula | C17H19N4O4BrS |
| Smiles | O=C(CN(CC1)CCN1S(c(cc1)ccc1Br)(=O)=O)N/N=C\c1ccco1 |
| InChI | InChI=1S/C17H19BrN4O4S/c18-14-3-5-16(6-4-14)27(24,25)22-9-7-21(8-10-22)13-17(23)20-19-12-15-2-1-11-26-15/h1-6,11-12H,7-10,13H2,(H,20,23) |
| InChIK | SWRAGCLZHDIIPC-UHFFFAOYSA-N |
| TotalMolweight | 455.332 |
| Molweight | 455.332 |
| MonoisotopicMass | 454.031037 |
| CLogP | 1.9126 |
| CLogS | -2.707 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 299.79 |
| Relative PSA | 0.2862 |
| PolarSurfaceArea | 103.6 |
| Druglikeness | 6.7306 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 7 |
| Symmetricatoms | 5 |
| Amides | 1 |
| Amines | 1 |
| AlkylAmines | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-N-[(Z)-furan-2-ylmethylideneamino]acetamide | 2 - 2-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-N-[(Z)-furan-2-ylmethylideneamino]acetamide