| MolName | 6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-N-(4-nitrophenyl)-2-N-[(Z)-pyridin-3-ylmethylideneamino]-1,3,5-triazine-2,4-diamine |
| MolecularFormula | C18H12N8O3F6 |
| Smiles | [O-][N+](c(cc1)ccc1Nc1nc(OC(C(F)(F)F)C(F)(F)F)nc(N/N=C\c2cnccc2)n1)=O |
| InChI | InChI=1S/C18H12F6N8O3/c19-17(20,21)13(18(22,23)24)35-16-29-14(27-11-3-5-12(6-4-11)32(33)34)28-15(30-16)31-26-9-10-2-1-7-25-8-10/h1-9,13H,(H2,27,28,29,30,31) |
| InChIK | SWSPBBPLZSYKBJ-UHFFFAOYSA-N |
| TotalMolweight | 502.334 |
| Molweight | 502.334 |
| MonoisotopicMass | 502.093655 |
| CLogP | 5.5346 |
| CLogS | -6.754 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 340.59 |
| Relative PSA | 0.3486 |
| PolarSurfaceArea | 143.03 |
| Druglikeness | -14.859 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.48571 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 17 |
| Electronegative Atoms | 17 |
| Rotatable Bond | 10 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 5 |
| Symmetricatoms | 8 |
| Aromatic Nitrogens | 4 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-N-(4-nitrophenyl)-2-N-[(Z)-pyridin-3-ylmethylideneamino]-1,3,5-triazine-2,4-diamine | 2 - 6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-N-(4-nitrophenyl)-2-N-[(Z)-pyridin-3-ylmethylideneamino]-1,3,5-triazine-2,4-diamine